C20H26N4O6S — CID 10095298
4-(dibutylamino)-3,5-dinitro-N-phenylbenzenesulfonamide (PubChem CID 10095298) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-(dibutylamino)-3,5-dinitro-N-phenylbenzenesulfonamide.
| Compound Name | 4-(dibutylamino)-3,5-dinitro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 10095298 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-(dibutylamino)-3,5-dinitro-N-phenylbenzenesulfonamide |
| SMILES | CCCCN(CCCC)c1c([N+](=O)[O-])cc(S(=O)(=O)Nc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O6S/c1-3-5-12-22(13-6-4-2)20-18(23(25)26)14-17(15-19(20)24(27)28)31(29,30)21-16-10-8-7-9-11-16/h7-11,14-15,21H,3-6,12-13H2,1-2H3 |
| InChIKey | FYMAZDOJZUMVIY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|