C18H29N5O6S — CID 154121190
4-(dipropylamino)-3,5-dinitro-N-(piperidin-1-ylmethyl)benzenesulfonamide (PubChem CID 154121190) has the molecular formula C18H29N5O6S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-(dipropylamino)-3,5-dinitro-N-(piperidin-1-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(dipropylamino)-3,5-dinitro-N-(piperidin-1-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 154121190 |
| Molecular Formula | C18H29N5O6S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-(dipropylamino)-3,5-dinitro-N-(piperidin-1-ylmethyl)benzenesulfonamide |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(S(=O)(=O)NCN2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N5O6S/c1-3-8-21(9-4-2)18-16(22(24)25)12-15(13-17(18)23(26)27)30(28,29)19-14-20-10-6-5-7-11-20/h12-13,19H,3-11,14H2,1-2H3 |
| InChIKey | ZMYWRTGJNLOLBT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|