C17H28N4O6S — CID 11774373
4-(dipropylamino)-3,5-dinitro-N-pentylbenzenesulfonamide (PubChem CID 11774373) has the molecular formula C17H28N4O6S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-(dipropylamino)-3,5-dinitro-N-pentylbenzenesulfonamide.
| Compound Name | 4-(dipropylamino)-3,5-dinitro-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 11774373 |
| Molecular Formula | C17H28N4O6S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-(dipropylamino)-3,5-dinitro-N-pentylbenzenesulfonamide |
| SMILES | CCCCCNS(=O)(=O)c1cc([N+](=O)[O-])c(N(CCC)CCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H28N4O6S/c1-4-7-8-9-18-28(26,27)14-12-15(20(22)23)17(16(13-14)21(24)25)19(10-5-2)11-6-3/h12-13,18H,4-11H2,1-3H3 |
| InChIKey | UOAYHICWJSTYNF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|