C17H26N4O8S — CID 54572253
methyl N-[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl-N-propylcarbamate (PubChem CID 54572253) has the molecular formula C17H26N4O8S and a molecular weight of 446.48 g/mol. Its IUPAC name is methyl N-[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl-N-propylcarbamate.
| Compound Name | methyl N-[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl-N-propylcarbamate |
|---|---|
| PubChem CID | 54572253 |
| Molecular Formula | C17H26N4O8S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | methyl N-[4-(dipropylamino)-3,5-dinitrophenyl]sulfonyl-N-propylcarbamate |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(S(=O)(=O)N(CCC)C(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O8S/c1-5-8-18(9-6-2)16-14(20(23)24)11-13(12-15(16)21(25)26)30(27,28)19(10-7-3)17(22)29-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | ZYDIJPGSFRYONR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|