C12H17N4O6S- — CID 54538994
2-(dipropylamino)-1,3-dinitro-5-(sulfinatoamino)benzene (PubChem CID 54538994) has the molecular formula C12H17N4O6S- and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(dipropylamino)-1,3-dinitro-5-(sulfinatoamino)benzene.
| Compound Name | 2-(dipropylamino)-1,3-dinitro-5-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 54538994 |
| Molecular Formula | C12H17N4O6S- |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-(dipropylamino)-1,3-dinitro-5-(sulfinatoamino)benzene |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(NS(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(13-23(21)22)8-11(12)16(19)20/h7-8,13H,3-6H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | AOGHEJUBHDOGMA-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|