C14H20N4O8S — CID 54212165
methyl N-[4-[ethyl(propyl)amino]-3,5-dinitrophenyl]sulfonyl-N-methylcarbamate (PubChem CID 54212165) has the molecular formula C14H20N4O8S and a molecular weight of 404.40 g/mol. Its IUPAC name is methyl N-[4-[ethyl(propyl)amino]-3,5-dinitrophenyl]sulfonyl-N-methylcarbamate.
| Compound Name | methyl N-[4-[ethyl(propyl)amino]-3,5-dinitrophenyl]sulfonyl-N-methylcarbamate |
|---|---|
| PubChem CID | 54212165 |
| Molecular Formula | C14H20N4O8S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl N-[4-[ethyl(propyl)amino]-3,5-dinitrophenyl]sulfonyl-N-methylcarbamate |
| SMILES | CCCN(CC)c1c([N+](=O)[O-])cc(S(=O)(=O)N(C)C(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O8S/c1-5-7-16(6-2)13-11(17(20)21)8-10(9-12(13)18(22)23)27(24,25)15(3)14(19)26-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | PWRKJICEWDVEJF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|