C15H23N3O5 — CID 54243892
1-(2,6-dinitro-4-propan-2-yl-N-propylanilino)propan-2-ol (PubChem CID 54243892) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-(2,6-dinitro-4-propan-2-yl-N-propylanilino)propan-2-ol.
| Compound Name | 1-(2,6-dinitro-4-propan-2-yl-N-propylanilino)propan-2-ol |
|---|---|
| PubChem CID | 54243892 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(2,6-dinitro-4-propan-2-yl-N-propylanilino)propan-2-ol |
| SMILES | CCCN(CC(C)O)c1c([N+](=O)[O-])cc(C(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O5/c1-5-6-16(9-11(4)19)15-13(17(20)21)7-12(10(2)3)8-14(15)18(22)23/h7-8,10-11,19H,5-6,9H2,1-4H3 |
| InChIKey | QRWYGJDRMYERTL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|