C14H22N2O2 — CID 68587667
4-ethyl-3-nitro-N,N-dipropylaniline (PubChem CID 68587667) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-ethyl-3-nitro-N,N-dipropylaniline.
| Compound Name | 4-ethyl-3-nitro-N,N-dipropylaniline |
|---|---|
| PubChem CID | 68587667 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-ethyl-3-nitro-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(CC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N2O2/c1-4-9-15(10-5-2)13-8-7-12(6-3)14(11-13)16(17)18/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | CCSOTHAKBCAEOE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|