C15H23N3O4S — CID 21205326
N-butyl-3-nitro-4-piperidin-1-ylbenzenesulfonamide (PubChem CID 21205326) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is N-butyl-3-nitro-4-piperidin-1-ylbenzenesulfonamide.
| Compound Name | N-butyl-3-nitro-4-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 21205326 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-butyl-3-nitro-4-piperidin-1-ylbenzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H23N3O4S/c1-2-3-9-16-23(21,22)13-7-8-14(15(12-13)18(19)20)17-10-5-4-6-11-17/h7-8,12,16H,2-6,9-11H2,1H3 |
| InChIKey | RJMAPAJUYPWSJM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|