C17H26N2O5S — CID 99985963
5-(3-ethoxypropylsulfamoyl)-2-piperidin-1-ylbenzoic acid (PubChem CID 99985963) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 5-(3-ethoxypropylsulfamoyl)-2-piperidin-1-ylbenzoic acid.
| Compound Name | 5-(3-ethoxypropylsulfamoyl)-2-piperidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 99985963 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 5-(3-ethoxypropylsulfamoyl)-2-piperidin-1-ylbenzoic acid |
| SMILES | CCOCCCNS(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H26N2O5S/c1-2-24-12-6-9-18-25(22,23)14-7-8-16(15(13-14)17(20)21)19-10-4-3-5-11-19/h7-8,13,18H,2-6,9-12H2,1H3,(H,20,21) |
| InChIKey | KQEBGHAWORHVHY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|