C18H21N3O5S — CID 9186405
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitro-N-phenylbenzenesulfonamide (PubChem CID 9186405) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitro-N-phenylbenzenesulfonamide.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 9186405 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-nitro-N-phenylbenzenesulfonamide |
| SMILES | C[C@H]1CN(c2ccc(S(=O)(=O)Nc3ccccc3)cc2[N+](=O)[O-])C[C@H](C)O1 |
| InChI | InChI=1S/C18H21N3O5S/c1-13-11-20(12-14(2)26-13)17-9-8-16(10-18(17)21(22)23)27(24,25)19-15-6-4-3-5-7-15/h3-10,13-14,19H,11-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | COOMPLAGABFUAQ-KBPBESRZSA-N |
| XLogP | 3.01 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|