C17H21ClN4O4S — CID 22272566
4-(1,4-diazepan-1-yl)-3-nitro-N-phenylbenzenesulfonamide;hydrochloride (PubChem CID 22272566) has the molecular formula C17H21ClN4O4S and a molecular weight of 412.90 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-3-nitro-N-phenylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-(1,4-diazepan-1-yl)-3-nitro-N-phenylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22272566 |
| Molecular Formula | C17H21ClN4O4S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-3-nitro-N-phenylbenzenesulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(S(=O)(=O)Nc2ccccc2)ccc1N1CCCNCC1 |
| InChI | InChI=1S/C17H20N4O4S.ClH/c22-21(23)17-13-15(26(24,25)19-14-5-2-1-3-6-14)7-8-16(17)20-11-4-9-18-10-12-20;/h1-3,5-8,13,18-19H,4,9-12H2;1H |
| InChIKey | REESKWQUUSBTCO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|