About 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+)
1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) (PubChem CID 23403357) has the molecular formula C17H21N4O4S2Y+2
and a molecular weight of 498.42 g/mol. Its IUPAC name is 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+).
Molecular Properties
| Compound Name | 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) |
| PubChem CID | 23403357 |
| Molecular Formula | C17H21N4O4S2Y+2 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) |
| SMILES | O=S([O-])Nc1cc(S(=O)(=O)Nc2ccccc2)ccc1N1CCCNCC1.[Y+3] |
| InChI | InChI=1S/C17H22N4O4S2.Y/c22-26(23)19-16-13-15(27(24,25)20-14-5-2-1-3-6-14)7-8-17(16)21-11-4-9-18-10-12-21;/h1-3,5-8,13,18-20H,4,9-12H2,(H,22,23);/q;+3/p-1 |
| InChIKey | QXGIPDDYFGPLNS-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+)?
The IUPAC name of 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) (CID 23403357) is 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+).
What is the SMILES notation for 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+)?
The canonical SMILES for 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) is O=S([O-])Nc1cc(S(=O)(=O)Nc2ccccc2)ccc1N1CCCNCC1.[Y+3].
What is the InChIKey of 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+)?
The InChIKey is QXGIPDDYFGPLNS-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H22N4O4S2.Y/c22-26(23)19-16-13-15(27(24,25)20-14-5-2-1-3-6-14)7-8-17(16)21-11-4-9-18-10-12-21;/h1-3,5-8,13,18-20H,4,9-12H2,(H,22,23);/q;+3/p-1.
What are the key properties of 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+)?
1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) has a molecular weight of 498.42 g/mol, XLogP of 1.49, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) is sourced from PubChem (CID 23403357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).