C17H21N4O4S2Y+2 — CID 23403357
1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) (PubChem CID 23403357) has the molecular formula C17H21N4O4S2Y+2 and a molecular weight of 498.42 g/mol. Its IUPAC name is 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+).
| Compound Name | 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) |
|---|---|
| PubChem CID | 23403357 |
| Molecular Formula | C17H21N4O4S2Y+2 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 1-[4-(phenylsulfamoyl)-2-(sulfinatoamino)phenyl]-1,4-diazepane;yttrium(3+) |
| SMILES | O=S([O-])Nc1cc(S(=O)(=O)Nc2ccccc2)ccc1N1CCCNCC1.[Y+3] |
| InChI | InChI=1S/C17H22N4O4S2.Y/c22-26(23)19-16-13-15(27(24,25)20-14-5-2-1-3-6-14)7-8-17(16)21-11-4-9-18-10-12-21;/h1-3,5-8,13,18-20H,4,9-12H2,(H,22,23);/q;+3/p-1 |
| InChIKey | QXGIPDDYFGPLNS-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|