C17H23ClN4O3S — CID 22272475
3-amino-N-(2-methoxyphenyl)-4-piperazin-1-ylbenzenesulfonamide;hydrochloride (PubChem CID 22272475) has the molecular formula C17H23ClN4O3S and a molecular weight of 398.92 g/mol. Its IUPAC name is 3-amino-N-(2-methoxyphenyl)-4-piperazin-1-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-amino-N-(2-methoxyphenyl)-4-piperazin-1-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22272475 |
| Molecular Formula | C17H23ClN4O3S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-amino-N-(2-methoxyphenyl)-4-piperazin-1-ylbenzenesulfonamide;hydrochloride |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(N2CCNCC2)c(N)c1.Cl |
| InChI | InChI=1S/C17H22N4O3S.ClH/c1-24-17-5-3-2-4-15(17)20-25(22,23)13-6-7-16(14(18)12-13)21-10-8-19-9-11-21;/h2-7,12,19-20H,8-11,18H2,1H3;1H |
| InChIKey | PZKUVPMTEYIEQM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|