C18H25ClN4O2S — CID 10157618
3-amino-4-(1,4-diazepan-1-yl)-N-methyl-N-phenylbenzenesulfonamide;hydrochloride (PubChem CID 10157618) has the molecular formula C18H25ClN4O2S and a molecular weight of 396.94 g/mol. Its IUPAC name is 3-amino-4-(1,4-diazepan-1-yl)-N-methyl-N-phenylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-amino-4-(1,4-diazepan-1-yl)-N-methyl-N-phenylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 10157618 |
| Molecular Formula | C18H25ClN4O2S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-amino-4-(1,4-diazepan-1-yl)-N-methyl-N-phenylbenzenesulfonamide;hydrochloride |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(N2CCCNCC2)c(N)c1.Cl |
| InChI | InChI=1S/C18H24N4O2S.ClH/c1-21(15-6-3-2-4-7-15)25(23,24)16-8-9-18(17(19)14-16)22-12-5-10-20-11-13-22;/h2-4,6-9,14,20H,5,10-13,19H2,1H3;1H |
| InChIKey | DEHKDJZMLDFXCM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|