C22H28F2N4O4S — CID 159608956
2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;2,2-difluoroacetic acid (PubChem CID 159608956) has the molecular formula C22H28F2N4O4S and a molecular weight of 482.55 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;2,2-difluoroacetic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 159608956 |
| Molecular Formula | C22H28F2N4O4S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;2,2-difluoroacetic acid |
| SMILES | Nc1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1N1CCCNCC1.O=C(O)C(F)F |
| InChI | InChI=1S/C20H26N4O2S.C2H2F2O2/c21-18-15-17(8-9-20(18)23-12-4-10-22-11-14-23)27(25,26)24-13-3-6-16-5-1-2-7-19(16)24;3-1(4)2(5)6/h1-2,5,7-9,15,22H,3-4,6,10-14,21H2;1H,(H,5,6) |
| InChIKey | MMKVDXYSHUFISF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|