C24H28F6N4O6S — CID 22272534
2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;bis(2,2,2-trifluoroacetic acid) (PubChem CID 22272534) has the molecular formula C24H28F6N4O6S and a molecular weight of 614.57 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 22272534 |
| Molecular Formula | C24H28F6N4O6S |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)aniline;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Nc1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1N1CCCNCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26N4O2S.2C2HF3O2/c21-18-15-17(8-9-20(18)23-12-4-10-22-11-14-23)27(25,26)24-13-3-6-16-5-1-2-7-19(16)24;2*3-2(4,5)1(6)7/h1-2,5,7-9,15,22H,3-4,6,10-14,21H2;2*(H,6,7) |
| InChIKey | OXPGVPJGNUTOIJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|