C16H20N4O2S — CID 22272481
3-amino-N-phenyl-4-piperazin-1-ylbenzenesulfonamide (PubChem CID 22272481) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-amino-N-phenyl-4-piperazin-1-ylbenzenesulfonamide.
| Compound Name | 3-amino-N-phenyl-4-piperazin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 22272481 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-amino-N-phenyl-4-piperazin-1-ylbenzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)Nc2ccccc2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C16H20N4O2S/c17-15-12-14(6-7-16(15)20-10-8-18-9-11-20)23(21,22)19-13-4-2-1-3-5-13/h1-7,12,18-19H,8-11,17H2 |
| InChIKey | VPJVAFWWXGTZPR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|