C18H24Cl2N4O2S — CID 10224673
3-amino-N-(3-chloro-2-methylphenyl)-4-(1,4-diazepan-1-yl)benzenesulfonamide;hydrochloride (PubChem CID 10224673) has the molecular formula C18H24Cl2N4O2S and a molecular weight of 431.39 g/mol. Its IUPAC name is 3-amino-N-(3-chloro-2-methylphenyl)-4-(1,4-diazepan-1-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 3-amino-N-(3-chloro-2-methylphenyl)-4-(1,4-diazepan-1-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 10224673 |
| Molecular Formula | C18H24Cl2N4O2S |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-amino-N-(3-chloro-2-methylphenyl)-4-(1,4-diazepan-1-yl)benzenesulfonamide;hydrochloride |
| SMILES | Cc1c(Cl)cccc1NS(=O)(=O)c1ccc(N2CCCNCC2)c(N)c1.Cl |
| InChI | InChI=1S/C18H23ClN4O2S.ClH/c1-13-15(19)4-2-5-17(13)22-26(24,25)14-6-7-18(16(20)12-14)23-10-3-8-21-9-11-23;/h2,4-7,12,21-22H,3,8-11,20H2,1H3;1H |
| InChIKey | TYYGPFSIOARHKV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|