C21H23Cl2N3O2S — CID 10204374
N-(4-chlorophenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide;hydrochloride (PubChem CID 10204374) has the molecular formula C21H23Cl2N3O2S and a molecular weight of 452.41 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide;hydrochloride.
| Compound Name | N-(4-chlorophenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 10204374 |
| Molecular Formula | C21H23Cl2N3O2S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-(4-chlorophenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide;hydrochloride |
| SMILES | CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(N2CCNCC2)c2ccccc12.Cl |
| InChI | InChI=1S/C21H22ClN3O2S.ClH/c1-24(17-8-6-16(22)7-9-17)28(26,27)21-11-10-20(25-14-12-23-13-15-25)18-4-2-3-5-19(18)21;/h2-11,23H,12-15H2,1H3;1H |
| InChIKey | LSIGKBJNNAIWQN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |