C22H24ClN3O2S — CID 10205203
N-(3-chloro-2-methylphenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide (PubChem CID 10205203) has the molecular formula C22H24ClN3O2S and a molecular weight of 429.97 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10205203 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N-methyl-4-piperazin-1-ylnaphthalene-1-sulfonamide |
| SMILES | Cc1c(Cl)cccc1N(C)S(=O)(=O)c1ccc(N2CCNCC2)c2ccccc12 |
| InChI | InChI=1S/C22H24ClN3O2S/c1-16-19(23)8-5-9-20(16)25(2)29(27,28)22-11-10-21(26-14-12-24-13-15-26)17-6-3-4-7-18(17)22/h3-11,24H,12-15H2,1-2H3 |
| InChIKey | LYAMMERMYCKKKA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |