C20H19Cl2N3O2S — CID 10277045
2,4-dichloro-N-(4-piperazin-1-ylnaphthalen-1-yl)benzenesulfonamide (PubChem CID 10277045) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is 2,4-dichloro-N-(4-piperazin-1-ylnaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(4-piperazin-1-ylnaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10277045 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2,4-dichloro-N-(4-piperazin-1-ylnaphthalen-1-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(N2CCNCC2)c2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O2S/c21-14-5-8-20(17(22)13-14)28(26,27)24-18-6-7-19(25-11-9-23-10-12-25)16-4-2-1-3-15(16)18/h1-8,13,23-24H,9-12H2 |
| InChIKey | XCAWMDQDDJWWHN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |