C22H25N3O2S — CID 10159893
4-(1,4-diazepan-1-yl)-N-(4-methylphenyl)naphthalene-1-sulfonamide (PubChem CID 10159893) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-N-(4-methylphenyl)naphthalene-1-sulfonamide.
| Compound Name | 4-(1,4-diazepan-1-yl)-N-(4-methylphenyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10159893 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-N-(4-methylphenyl)naphthalene-1-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N3CCCNCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-17-7-9-18(10-8-17)24-28(26,27)22-12-11-21(19-5-2-3-6-20(19)22)25-15-4-13-23-14-16-25/h2-3,5-12,23-24H,4,13-16H2,1H3 |
| InChIKey | QYJLWBNOGLTXPJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |