C16H11Cl2NO2S — CID 70133318
2,4-dichloro-N-naphthalen-1-ylbenzenesulfonamide (PubChem CID 70133318) has the molecular formula C16H11Cl2NO2S and a molecular weight of 352.24 g/mol. Its IUPAC name is 2,4-dichloro-N-naphthalen-1-ylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-naphthalen-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 70133318 |
| Molecular Formula | C16H11Cl2NO2S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2,4-dichloro-N-naphthalen-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NO2S/c17-12-8-9-16(14(18)10-12)22(20,21)19-15-7-3-5-11-4-1-2-6-13(11)15/h1-10,19H |
| InChIKey | PKTXIRUJZHRVPR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |