C20H11Cl2NO6S — CID 175227931
2,4-dichloro-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide (PubChem CID 175227931) has the molecular formula C20H11Cl2NO6S and a molecular weight of 464.28 g/mol. Its IUPAC name is 2,4-dichloro-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 175227931 |
| Molecular Formula | C20H11Cl2NO6S |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | 2,4-dichloro-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(NS(=O)(=O)c1ccc(Cl)cc1Cl)c(O)c2O |
| InChI | InChI=1S/C20H11Cl2NO6S/c21-9-5-6-15(13(22)7-9)30(28,29)23-14-8-12-16(20(27)19(14)26)18(25)11-4-2-1-3-10(11)17(12)24/h1-8,23,26-27H |
| InChIKey | DAWJJCHAKNBHSK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|