C20H12FNO6S — CID 165082965
N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluorobenzenesulfonamide (PubChem CID 165082965) has the molecular formula C20H12FNO6S and a molecular weight of 413.38 g/mol. Its IUPAC name is N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 165082965 |
| Molecular Formula | C20H12FNO6S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluorobenzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(NS(=O)(=O)c1ccc(F)cc1)c(O)c2O |
| InChI | InChI=1S/C20H12FNO6S/c21-10-5-7-11(8-6-10)29(27,28)22-15-9-14-16(20(26)19(15)25)18(24)13-4-2-1-3-12(13)17(14)23/h1-9,22,25-26H |
| InChIKey | VKRSEEFFCJGXRS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|