C21H11F4NO6S — CID 162659078
N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 162659078) has the molecular formula C21H11F4NO6S and a molecular weight of 481.38 g/mol. Its IUPAC name is N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162659078 |
| Molecular Formula | C21H11F4NO6S |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(NS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1)c(O)c2O |
| InChI | InChI=1S/C21H11F4NO6S/c22-14-6-5-9(7-13(14)21(23,24)25)33(31,32)26-15-8-12-16(20(30)19(15)29)18(28)11-4-2-1-3-10(11)17(12)27/h1-8,26,29-30H |
| InChIKey | BCUAKYWNTIAODD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|