C21H15F4N3O4S — CID 148671075
N-[2-(3,4-dihydropyridin-3-ylmethyl)-1,3-dioxoisoindol-4-yl]-4-fluoro-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 148671075) has the molecular formula C21H15F4N3O4S and a molecular weight of 481.43 g/mol. Its IUPAC name is N-[2-(3,4-dihydropyridin-3-ylmethyl)-1,3-dioxoisoindol-4-yl]-4-fluoro-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(3,4-dihydropyridin-3-ylmethyl)-1,3-dioxoisoindol-4-yl]-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 148671075 |
| Molecular Formula | C21H15F4N3O4S |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[2-(3,4-dihydropyridin-3-ylmethyl)-1,3-dioxoisoindol-4-yl]-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1c2cccc(NS(=O)(=O)c3ccc(F)c(C(F)(F)F)c3)c2C(=O)N1CC1C=NC=CC1 |
| InChI | InChI=1S/C21H15F4N3O4S/c22-16-7-6-13(9-15(16)21(23,24)25)33(31,32)27-17-5-1-4-14-18(17)20(30)28(19(14)29)11-12-3-2-8-26-10-12/h1-2,4-10,12,27H,3,11H2 |
| InChIKey | NPSOCYWQNGUHRE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|