C23H14F3N3O4S — CID 118204746
N-[2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 118204746) has the molecular formula C23H14F3N3O4S and a molecular weight of 485.44 g/mol. Its IUPAC name is N-[2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118204746 |
| Molecular Formula | C23H14F3N3O4S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N-[2-[(3-cyanophenyl)methyl]-1,3-dioxoisoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | N#Cc1cccc(CN2C(=O)c3cccc(NS(=O)(=O)c4ccc(C(F)(F)F)cc4)c3C2=O)c1 |
| InChI | InChI=1S/C23H14F3N3O4S/c24-23(25,26)16-7-9-17(10-8-16)34(32,33)28-19-6-2-5-18-20(19)22(31)29(21(18)30)13-15-4-1-3-14(11-15)12-27/h1-11,28H,13H2 |
| InChIKey | NOMTYIQWLUAQSJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|