C22H15Cl2F3N3O4S+ — CID 118204867
4-chloro-N-[7-chloro-2-[(1-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 118204867) has the molecular formula C22H15Cl2F3N3O4S+ and a molecular weight of 545.35 g/mol. Its IUPAC name is 4-chloro-N-[7-chloro-2-[(1-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[7-chloro-2-[(1-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118204867 |
| Molecular Formula | C22H15Cl2F3N3O4S+ |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 544.01 |
| IUPAC Name | 4-chloro-N-[7-chloro-2-[(1-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C[n+]1cccc(CN2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(Cl)c(C(F)(F)F)c4)c3C2=O)c1 |
| InChI | InChI=1S/C22H14Cl2F3N3O4S/c1-29-8-2-3-12(10-29)11-30-20(31)18-16(24)6-7-17(19(18)21(30)32)28-35(33,34)13-4-5-15(23)14(9-13)22(25,26)27/h2-10H,11H2,1H3/p+1 |
| InChIKey | XWYGDVNPXLQRGM-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|