C22H16F3N3O5S — CID 118204961
N-[7-methoxy-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 118204961) has the molecular formula C22H16F3N3O5S and a molecular weight of 491.45 g/mol. Its IUPAC name is N-[7-methoxy-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[7-methoxy-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118204961 |
| Molecular Formula | C22H16F3N3O5S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[7-methoxy-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c2c1C(=O)N(Cc1cccnc1)C2=O |
| InChI | InChI=1S/C22H16F3N3O5S/c1-33-17-9-8-16(27-34(31,32)15-6-4-14(5-7-15)22(23,24)25)18-19(17)21(30)28(20(18)29)12-13-3-2-10-26-11-13/h2-11,27H,12H2,1H3 |
| InChIKey | DZFYDOFLEIUBQM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|