C21H14ClF3N3O5S+ — CID 118204685
N-[7-chloro-2-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 118204685) has the molecular formula C21H14ClF3N3O5S+ and a molecular weight of 512.87 g/mol. Its IUPAC name is N-[7-chloro-2-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[7-chloro-2-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118204685 |
| Molecular Formula | C21H14ClF3N3O5S+ |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | N-[7-chloro-2-[(1-hydroxypyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1c2c(Cl)ccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)c2C(=O)N1Cc1ccc[n+](O)c1 |
| InChI | InChI=1S/C21H13ClF3N3O5S/c22-15-6-7-16(26-34(32,33)14-5-1-4-13(9-14)21(23,24)25)18-17(15)19(29)28(20(18)30)11-12-3-2-8-27(31)10-12/h1-10H,11H2,(H-,26,30,31)/p+1 |
| InChIKey | VNFLTNOCUCYZKP-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|