C16H11ClF3NO4S — CID 155125581
(E)-3-[3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 155125581) has the molecular formula C16H11ClF3NO4S and a molecular weight of 405.78 g/mol. Its IUPAC name is (E)-3-[3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155125581 |
| Molecular Formula | C16H11ClF3NO4S |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | (E)-3-[3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C16H11ClF3NO4S/c17-13-6-5-11(16(18,19)20)9-14(13)21-26(24,25)12-3-1-2-10(8-12)4-7-15(22)23/h1-9,21H,(H,22,23)/b7-4+ |
| InChIKey | FIBBWKHMQSNONI-QPJJXVBHSA-N |
| XLogP | 4.26 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|