C18H18ClF3N2O3S — CID 26583597
3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]-N,N-diethylbenzamide (PubChem CID 26583597) has the molecular formula C18H18ClF3N2O3S and a molecular weight of 434.87 g/mol. Its IUPAC name is 3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]-N,N-diethylbenzamide.
| Compound Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 26583597 |
| Molecular Formula | C18H18ClF3N2O3S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C18H18ClF3N2O3S/c1-3-24(4-2)17(25)12-6-5-7-14(10-12)28(26,27)23-16-11-13(18(20,21)22)8-9-15(16)19/h5-11,23H,3-4H2,1-2H3 |
| InChIKey | VYFDUZHDDRZWEC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |