C19H25N3O3S — CID 109065116
3-[[4-(dimethylamino)phenyl]sulfamoyl]-N,N-diethylbenzamide (PubChem CID 109065116) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]sulfamoyl]-N,N-diethylbenzamide.
| Compound Name | 3-[[4-(dimethylamino)phenyl]sulfamoyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 109065116 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]sulfamoyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(S(=O)(=O)Nc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-5-22(6-2)19(23)15-8-7-9-18(14-15)26(24,25)20-16-10-12-17(13-11-16)21(3)4/h7-14,20H,5-6H2,1-4H3 |
| InChIKey | GPRUUIAHPKPOBI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|