C24H24FN3O4S — CID 26712749
N,N-diethyl-3-[[3-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 26712749) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is N,N-diethyl-3-[[3-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | N,N-diethyl-3-[[3-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 26712749 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N,N-diethyl-3-[[3-[(4-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cccc(S(=O)(=O)Nc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C24H24FN3O4S/c1-3-28(4-2)24(30)18-8-5-9-21(15-18)26-23(29)17-7-6-10-22(16-17)33(31,32)27-20-13-11-19(25)12-14-20/h5-16,27H,3-4H2,1-2H3,(H,26,29) |
| InChIKey | AQRFZYAALVEDLR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |