C19H20F2N2O4S — CID 26070782
3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N,N-diethylbenzamide (PubChem CID 26070782) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 26070782 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F2N2O4S/c1-3-23(4-2)18(25)14-6-5-7-15(12-14)22-17(24)13-8-10-16(11-9-13)28(26,27)19(20)21/h5-12,19H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | FJRJVISVWBRWIK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |