C17H16F2N2O4S — CID 8782088
3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N-ethylbenzamide (PubChem CID 8782088) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 8782088 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-[[4-(difluoromethylsulfonyl)benzoyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)c1 |
| InChI | InChI=1S/C17H16F2N2O4S/c1-2-20-15(22)12-4-3-5-13(10-12)21-16(23)11-6-8-14(9-7-11)26(24,25)17(18)19/h3-10,17H,2H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | KDPHPNZPKMSOOC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |