C14H11F2NO4S — CID 78829368
4-(difluoromethylsulfonyl)-N-(3-hydroxyphenyl)benzamide (PubChem CID 78829368) has the molecular formula C14H11F2NO4S and a molecular weight of 327.31 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(3-hydroxyphenyl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(3-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 78829368 |
| Molecular Formula | C14H11F2NO4S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(3-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H11F2NO4S/c15-14(16)22(20,21)12-6-4-9(5-7-12)13(19)17-10-2-1-3-11(18)8-10/h1-8,14,18H,(H,17,19) |
| InChIKey | PESRWMKMVOSFTA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |