C25H25ClN3O5S+ — CID 134501935
4-tert-butyl-N-[7-chloro-2-[(1-hydroxy-6-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]benzenesulfonamide (PubChem CID 134501935) has the molecular formula C25H25ClN3O5S+ and a molecular weight of 515.01 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-[(1-hydroxy-6-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-[(1-hydroxy-6-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134501935 |
| Molecular Formula | C25H25ClN3O5S+ |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-[(1-hydroxy-6-methylpyridin-1-ium-3-yl)methyl]-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(CN2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)c[n+]1O |
| InChI | InChI=1S/C25H24ClN3O5S/c1-15-5-6-16(14-29(15)32)13-28-23(30)21-19(26)11-12-20(22(21)24(28)31)27-35(33,34)18-9-7-17(8-10-18)25(2,3)4/h5-12,14H,13H2,1-4H3,(H-,27,31,32)/p+1 |
| InChIKey | QEHDUGFHVPRZEW-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|