C25H24ClN3O6S — CID 118204763
4-tert-butyl-N-[7-chloro-2-(6-ethoxy-1-oxidopyridin-1-ium-2-yl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide (PubChem CID 118204763) has the molecular formula C25H24ClN3O6S and a molecular weight of 530.00 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(6-ethoxy-1-oxidopyridin-1-ium-2-yl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(6-ethoxy-1-oxidopyridin-1-ium-2-yl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118204763 |
| Molecular Formula | C25H24ClN3O6S |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(6-ethoxy-1-oxidopyridin-1-ium-2-yl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
| SMILES | CCOc1cccc(N2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)[n+]1[O-] |
| InChI | InChI=1S/C25H24ClN3O6S/c1-5-35-20-8-6-7-19(29(20)32)28-23(30)21-17(26)13-14-18(22(21)24(28)31)27-36(33,34)16-11-9-15(10-12-16)25(2,3)4/h6-14,27H,5H2,1-4H3 |
| InChIKey | MRZAYYSIRRXKFL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|