C25H21ClN4O4S — CID 118205008
4-tert-butyl-N-[7-chloro-2-(2-cyano-5-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide (PubChem CID 118205008) has the molecular formula C25H21ClN4O4S and a molecular weight of 508.99 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(2-cyano-5-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(2-cyano-5-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118205008 |
| Molecular Formula | C25H21ClN4O4S |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(2-cyano-5-methyl-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
| SMILES | Cc1cnc(C#N)c(N2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)c1 |
| InChI | InChI=1S/C25H21ClN4O4S/c1-14-11-20(19(12-27)28-13-14)30-23(31)21-17(26)9-10-18(22(21)24(30)32)29-35(33,34)16-7-5-15(6-8-16)25(2,3)4/h5-11,13,29H,1-4H3 |
| InChIKey | OYXRYYGTACIRAJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|