C24H19ClN4O3S — CID 118204729
4-tert-butyl-N-[7-chloro-2-(5-cyano-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide (PubChem CID 118204729) has the molecular formula C24H19ClN4O3S and a molecular weight of 478.96 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(5-cyano-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(5-cyano-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 118204729 |
| Molecular Formula | C24H19ClN4O3S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(5-cyano-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfinamide |
| SMILES | CC(C)(C)c1ccc(S(=O)Nc2ccc(Cl)c3c2C(=O)N(c2cncc(C#N)c2)C3=O)cc1 |
| InChI | InChI=1S/C24H19ClN4O3S/c1-24(2,3)15-4-6-17(7-5-15)33(32)28-19-9-8-18(25)20-21(19)23(31)29(22(20)30)16-10-14(11-26)12-27-13-16/h4-10,12-13,28H,1-3H3 |
| InChIKey | OMBVMAVFBXJZOA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|