C17H19ClFN3O2S — CID 143613948
4-tert-butyl-N-[4-chloro-5-fluoro-2-(hydrazinecarbonyl)phenyl]benzenesulfinamide (PubChem CID 143613948) has the molecular formula C17H19ClFN3O2S and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-chloro-5-fluoro-2-(hydrazinecarbonyl)phenyl]benzenesulfinamide.
| Compound Name | 4-tert-butyl-N-[4-chloro-5-fluoro-2-(hydrazinecarbonyl)phenyl]benzenesulfinamide |
|---|---|
| PubChem CID | 143613948 |
| Molecular Formula | C17H19ClFN3O2S |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-tert-butyl-N-[4-chloro-5-fluoro-2-(hydrazinecarbonyl)phenyl]benzenesulfinamide |
| SMILES | CC(C)(C)c1ccc(S(=O)Nc2cc(F)c(Cl)cc2C(=O)NN)cc1 |
| InChI | InChI=1S/C17H19ClFN3O2S/c1-17(2,3)10-4-6-11(7-5-10)25(24)22-15-9-14(19)13(18)8-12(15)16(23)21-20/h4-9,22H,20H2,1-3H3,(H,21,23) |
| InChIKey | FJFAHOZTMKCKLN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|