C8H8Cl2N4O2 — CID 124926031
2,5-dichlorobenzene-1,4-dicarbohydrazide (PubChem CID 124926031) has the molecular formula C8H8Cl2N4O2 and a molecular weight of 263.08 g/mol. Its IUPAC name is 2,5-dichlorobenzene-1,4-dicarbohydrazide.
| Compound Name | 2,5-dichlorobenzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 124926031 |
| Molecular Formula | C8H8Cl2N4O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2,5-dichlorobenzene-1,4-dicarbohydrazide |
| SMILES | NNC(=O)c1cc(Cl)c(C(=O)NN)cc1Cl |
| InChI | InChI=1S/C8H8Cl2N4O2/c9-5-1-3(7(15)13-11)6(10)2-4(5)8(16)14-12/h1-2H,11-12H2,(H,13,15)(H,14,16) |
| InChIKey | FRSGRHHCUVMLKY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|