C7H5BrCl2N2O — CID 169499880
4-bromo-3,5-dichlorobenzohydrazide (PubChem CID 169499880) has the molecular formula C7H5BrCl2N2O and a molecular weight of 283.94 g/mol. Its IUPAC name is 4-bromo-3,5-dichlorobenzohydrazide.
| Compound Name | 4-bromo-3,5-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 169499880 |
| Molecular Formula | C7H5BrCl2N2O |
| Molecular Weight | 283.94 g/mol |
| Exact Mass | 281.90 |
| IUPAC Name | 4-bromo-3,5-dichlorobenzohydrazide |
| SMILES | NNC(=O)c1cc(Cl)c(Br)c(Cl)c1 |
| InChI | InChI=1S/C7H5BrCl2N2O/c8-6-4(9)1-3(2-5(6)10)7(13)12-11/h1-2H,11H2,(H,12,13) |
| InChIKey | RPSYCXFJYMQXSX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.94 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|