C9H9ClN2O3 — CID 43236687
5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide (PubChem CID 43236687) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide.
| Compound Name | 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
|---|---|
| PubChem CID | 43236687 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
| SMILES | NNC(=O)c1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C9H9ClN2O3/c10-6-3-5(9(13)12-11)4-7-8(6)15-2-1-14-7/h3-4H,1-2,11H2,(H,12,13) |
| InChIKey | ZHQFWJFDOPOKEY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|