C16H18ClNO7 — CID 33245236
diethyl 2-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanedioate (PubChem CID 33245236) has the molecular formula C16H18ClNO7 and a molecular weight of 371.77 g/mol. Its IUPAC name is diethyl 2-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanedioate.
| Compound Name | diethyl 2-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanedioate |
|---|---|
| PubChem CID | 33245236 |
| Molecular Formula | C16H18ClNO7 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | diethyl 2-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1cc(Cl)c2c(c1)OCCO2)C(=O)OCC |
| InChI | InChI=1S/C16H18ClNO7/c1-3-22-15(20)12(16(21)23-4-2)18-14(19)9-7-10(17)13-11(8-9)24-5-6-25-13/h7-8,12H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | PQXIIEXMZSJGEE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|