C8H9ClN2O3 — CID 67488577
3-chloro-4-hydroxy-5-methoxybenzohydrazide (PubChem CID 67488577) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-5-methoxybenzohydrazide.
| Compound Name | 3-chloro-4-hydroxy-5-methoxybenzohydrazide |
|---|---|
| PubChem CID | 67488577 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 3-chloro-4-hydroxy-5-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NN)cc(Cl)c1O |
| InChI | InChI=1S/C8H9ClN2O3/c1-14-6-3-4(8(13)11-10)2-5(9)7(6)12/h2-3,12H,10H2,1H3,(H,11,13) |
| InChIKey | DRJKDHOZRMPXNP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|