C20H19ClN2O6 — CID 57073945
4-[5-(hydrazinecarbonyl)-2,3-dimethoxyphenyl]but-2-ynyl 3-chloro-4-hydroxybenzoate (PubChem CID 57073945) has the molecular formula C20H19ClN2O6 and a molecular weight of 418.83 g/mol. Its IUPAC name is 4-[5-(hydrazinecarbonyl)-2,3-dimethoxyphenyl]but-2-ynyl 3-chloro-4-hydroxybenzoate.
| Compound Name | 4-[5-(hydrazinecarbonyl)-2,3-dimethoxyphenyl]but-2-ynyl 3-chloro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 57073945 |
| Molecular Formula | C20H19ClN2O6 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 4-[5-(hydrazinecarbonyl)-2,3-dimethoxyphenyl]but-2-ynyl 3-chloro-4-hydroxybenzoate |
| SMILES | COc1cc(C(=O)NN)cc(CC#CCOC(=O)c2ccc(O)c(Cl)c2)c1OC |
| InChI | InChI=1S/C20H19ClN2O6/c1-27-17-11-14(19(25)23-22)9-12(18(17)28-2)5-3-4-8-29-20(26)13-6-7-16(24)15(21)10-13/h6-7,9-11,24H,5,8,22H2,1-2H3,(H,23,25) |
| InChIKey | YJRBOEVISDCVNW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|